FL5FFCNSS001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=3,5,7,8,3',4'-Hexahydroxyflavone 3-O-sulfate |
|Common Name=&&Gossypetin 3-O-sulfate&& | |Common Name=&&Gossypetin 3-O-sulfate&& | ||
|CAS=- | |CAS=- | ||
|KNApSAcK=C00004987 | |KNApSAcK=C00004987 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | - |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FFCNSS001.mol |
Gossypetin 3-O-sulfate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C15H10O11S |
Exact Mass | 397.994381852 |
Average Mass | 398.2993 |
SMILES | Oc(c3)c(O)cc(c3)C(O1)=C(OS(O)(=O)=O)C(=O)c(c(O)2)c |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|