FL6D3ANS0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |Sysname=(2R)-3,4-Dihydro-2-(4-hydroxyphenyl)-2H-1-benzopyran-3alpha,4alpha,7,8-tetrol |
|Common Name=&&Epioritin-4alpha-ol&& | |Common Name=&&Epioritin-4alpha-ol&& | ||
|CAS=577-30-0 | |CAS=577-30-0 | ||
|KNApSAcK=C00009005 | |KNApSAcK=C00009005 | ||
}} | }} | ||
Revision as of 09:00, 12 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 577-30-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL6D3ANS0002.mol |
| Epioritin-4alpha-ol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | |
| Common Name |
|
| Symbol | |
| Formula | C15H14O6 |
| Exact Mass | 290.07903818 |
| Average Mass | 290.26806 |
| SMILES | Oc(c3)ccc(c3)C(O1)C(O)C(O)c(c2)c1c(O)c(O)c2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
