FL6F1CNP0003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=(2S)-3,3',4,4'-Tetrahydro-2',2'-dimethyl-7'-(3-methyl-2-butenyl)-2,6'-bi[2H-1-benzopyran]-3',4',7,8'-tetrol | |SysName=(2S)-3,3',4,4'-Tetrahydro-2',2'-dimethyl-7'-(3-methyl-2-butenyl)-2,6'-bi[2H-1-benzopyran]-3',4',7,8'-tetrol | ||
| − | |Common Name=&&Broussoflavan A&& | + | |Common Name=&&Broussoflavan A&&(2S)-3,3',4,4'-Tetrahydro-2',2'-dimethyl-7'-(3-methyl-2-butenyl)-2,6'-bi[2H-1-benzopyran]-3',4',7,8'-tetrol&& |
|CAS=160262-53-3 | |CAS=160262-53-3 | ||
|KNApSAcK=C00008790 | |KNApSAcK=C00008790 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 160262-53-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL6F1CNP0003.mol |
| Broussoflavan A | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2S)-3,3',4,4'-Tetrahydro-2',2'-dimethyl-7'-(3-methyl-2-butenyl)-2,6'-bi[2H-1-benzopyran]-3',4',7,8'-tetrol |
| Common Name |
|
| Symbol | |
| Formula | C25H30O6 |
| Exact Mass | 426.204238692 |
| Average Mass | 426.5021 |
| SMILES | C(C1)C(c(c3CC=C(C)C)cc(C(O)4)c(OC(C4O)(C)C)c(O)3)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
