FL7DAAGO0002
From Metabolomics.JP
(Difference between revisions)
m (FL7DAAGS0002 moved to FL7DAAGO0002) |
Revision as of 14:53, 7 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 53948-06-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL7DAAGO0002.mol |
| Apigeninidin 7-glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,4'-Trihydroxyflavylium 7-glucoside |
| Common Name |
|
| Symbol | |
| Formula | C21H21O9 |
| Exact Mass | 417.11855727 |
| Average Mass | 417.38604 |
| SMILES | Oc(c4)ccc(c4)c(c3)[o+1]c(c(c3)2)cc(cc2O)OC(O1)C(O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
