FLIAAANS0001
From Metabolomics.JP
(Difference between revisions)
| Line 3: | Line 3: | ||
{{Metabolite | {{Metabolite | ||
|SysName=5,7,4'-Trihydroxyisoflavone | |SysName=5,7,4'-Trihydroxyisoflavone | ||
| − | |Common Name= | + | |Common Name=&&Genistein&&Genisteol&&Prunetol&&Sophoricol&&Differenol A&&5,7,4'-Trihydroxyisoflavone&& |
|CAS=446-72-0 | |CAS=446-72-0 | ||
|KNApSAcK=C00002526 | |KNApSAcK=C00002526 | ||
}} | }} | ||
Revision as of 03:53, 11 October 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIAAA Genistein (56 pages) : FLIAAANS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 446-72-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIAAANS0001.mol |
| Genistein | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,4'-Trihydroxyisoflavone |
| Common Name |
|
| Symbol | |
| Formula | C15H10O5 |
| Exact Mass | 270.05282343 |
| Average Mass | 270.2369 |
| SMILES | Oc(c3)ccc(c3)C(=C2)C(=O)c(c(O)1)c(O2)cc(O)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
