LBF20406AM11
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7027 |
| LipidMaps | LMFA08020013 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM11.mol |
| |
| Structural Information | |
| Systematic Name | N-amyl arachidohoyl amide |
| Common Name | |
| Symbol | |
| Formula | C25H43NO |
| Exact Mass | 373.334465003 |
| Average Mass | 373.61505999999997 |
| SMILES | C(CCCNC(CCCC=CCC=CCC=CCC=CCCCCC)=O)C |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.70 (br s lH), 5.23-5.33 (m, 8H), 3.15 (q, J=3Hz, 2H), 2.71-2.77(m, 6H), 1.97-2.16 (m, 6H), 1.58-1.68 (m, 2H), 1.18-1.42 (m, l2H), 0.79-0.85 (m, 6H). <<7001>> |
| Chromatograms | |
