LBF20406AM32
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7049 |
LipidMaps | LMFA08020035 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM32.mol |
Structural Information | |
---|---|
Systematic Name | N-isopropyl alpha-methyl arachidonoyl amide |
Common Name | |
Symbol | |
Formula | C24H41NO |
Exact Mass | 359.318814939 |
Average Mass | 359.58847999999995 |
SMILES | N(C(C(C)CCC=CCC=CCC=CCC=CCCCCC)=O)C(C)C |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.30-5.42 (m, 8H), 4.02-4.14 (m, lH), 2.76-2.90 (m, 6H), 1.92-2.12 (m, 5H), 1.10-1.60 (series of m, 17H), 0.89 (t, J=6.9Hz, 3H). <<7001>> |
Chromatograms |