LBF20406AM32
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7049 |
| LipidMaps | LMFA08020035 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM32.mol |
| |
| Structural Information | |
| Systematic Name | N-isopropyl alpha-methyl arachidonoyl amide |
| Common Name | |
| Symbol | |
| Formula | C24H41NO |
| Exact Mass | 359.318814939 |
| Average Mass | 359.58847999999995 |
| SMILES | N(C(C(C)CCC=CCC=CCC=CCC=CCCCCC)=O)C(C)C |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.30-5.42 (m, 8H), 4.02-4.14 (m, lH), 2.76-2.90 (m, 6H), 1.92-2.12 (m, 5H), 1.10-1.60 (series of m, 17H), 0.89 (t, J=6.9Hz, 3H). <<7001>> |
| Chromatograms | |
