BMFYB5CAe006
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C01107 |
KNApSAcK | |
CDX file | |
MOL file | BMFYB5CAe006.mol |
(R) -5-Phosphomevalonate | |
---|---|
Structural Information | |
Systematic Name | (R) -Mevalonic acid 5-phosphate |
Common Name |
|
Symbol | |
Formula | C6H13O7P |
Exact Mass | 228.0398 |
Average Mass | 228.1369 |
SMILES | OC(=O)C[C@@](C)(O)CCOP(O)(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways