LBF18206HP04
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA8005 |
LipidMaps | LMFA01040008 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18206HP04.mol |
![]() | |
Structural Information | |
Systematic Name | 8-Hydroperoxy-9,12-Octadecadienoic Acid |
Common Name | |
Symbol | |
Formula | C18H32O4 |
Exact Mass | 312.23005951199997 |
Average Mass | 312.44428 |
SMILES | CCCCCC=CCC=CC(OO)CCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(after methanolysis, reduction and trimethylsilylation) <<8050>: m/e= 292[M-HOTMS], 271[CH=CH-CH(OTMS)-(CH2)6COOCH3], 239[M-(CH2)6C00CH3], 173[SMTO=CH-(CH2)6COOCH3-TMS+H], 149[239-HOTMS] standard peak |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H-NMR (after methanolyzation, reduction and 400MHz )<<8050>>: olefinic protons(5.91-5.51ppm), C8 (4.45ppm), C11(2.84ppm), C14(2.05ppm),J9-10= J12-13= 10.7Å }0.2Hz (cis) |
Chromatograms |