LBF18206SC05
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0159 |
LipidMaps | LMFA01030120 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18206SC05.mol |
Linoleic acid | |
---|---|
![]() | |
Structural Information | |
Systematic Name | cis-9, cis-12-Octadecadienoic acid |
Common Name |
|
Symbol | |
Formula | C18H32O2 |
Exact Mass | 280.240230268 |
Average Mass | 280.44548000000003 |
SMILES | CCCCCC=CCC=CCCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | -5°C |
Boiling Point | 229°C to 230°C at 16mmHg |
Density | dX420 0.9031 |
Optical Rotation | 1.4711 at 20°C |
Reflactive Index | |
Solubility | soluble in acetone, alcohol, ether and petroleum ether.<<0193>><<0351>><<0378>><<0409>><<0410>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms | Gas liquid chromatogram ![]() (provided by Dr. Akiko Horiuchi). |