LBF18206SC08
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0162 |
LipidMaps | LMFA01030123 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18206SC08.mol |
Linolelaidic | |
---|---|
Structural Information | |
Systematic Name | trans-9, trans-12-Octadecadienoic acid |
Common Name |
|
Symbol | |
Formula | C18H32O2 |
Exact Mass | 280.240230268 |
Average Mass | 280.44548000000003 |
SMILES | CCCCCC=CCC=CCCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | 28°C to 29°C |
Boiling Point | 179°C to 183°C at 0.8mmHg |
Density | |
Optical Rotation | 1.4641 at 27°C |
Reflactive Index | |
Solubility | soluble in alcohol, ether, methyl alcohol and petroleum ether.<<0127>><<0193>><<0275>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |