LBF18207MO01
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | DFA8033 |
| LipidMaps | LMFA01080002 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18207MO01.mol |
| |
| Structural Information | |
| Systematic Name | 13-Hydroxy-8-Methoxy-9,11-Octadecadienoic Acid |
| Common Name | |
| Symbol | |
| Formula | C19H34O4 |
| Exact Mass | 326.24570957599997 |
| Average Mass | 326.47086 |
| SMILES | CCCCCC(O)C=CC=CC(OC)CCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | GC-EI-MS(after methanolysis and trimethylsilylation)<<8054>>: m/e=397[M-CH3], 380[M-CH3OH], 341[M-(CH2)4CH3], 322[M-HOTMS], 309[M-(CH2)4CH3-CH3OH], 269[M-(CH2)6COOCH3], 237[269-CH3OH], 187[CH3OCH-(CH2)6COOCH3], 179[269-HOTMS], 173[SMTO=CH-(CH2)4CH3], 133[CH3O-CH=OTMS] |
| UV Spectra | lMeOH/max=230mm<<8054>> |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
