LBF19000BC01
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0242 |
LipidMaps | LMFA01020017 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF19000BC01.mol |
Isoarachidic acid | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 18-Methylnonadecanoic acid |
Common Name |
|
Symbol | |
Formula | C20H40O2 |
Exact Mass | 312.302830524 |
Average Mass | 312.53040000000004 |
SMILES | C(CCCCCCCCC(O)=O)CCCCCCCC(C)C |
Physicochemical Information | |
Melting Point | 75.3°C |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | soluble in ethanol , ether and petroleum ether.<<0357>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |