LBF20406AM35
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | XPR7052 |
LipidMaps | LMFA08020038 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM35.mol |
![]() | |
Structural Information | |
Systematic Name | N- ( (R) - (-) -1-methyl-2-hydroxyethyl) a ,a -dimethylarachidonoyl amide |
Common Name | |
Symbol | |
Formula | C25H43NO2 |
Exact Mass | 389.329379625 |
Average Mass | 389.61446 |
SMILES | C(=CCC=CCC=CCC=CCCCCC)CCC(C)(C)C(N[C@H](CO)C)=O |
Physicochemical Information | |
Melting Point | colorless oil<<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.80 (br s, lH), 5.30-5.42 (m, 8H), 4.01-4.12 (m, lH), 3.60-3.68 (m, lH), 3.50-3.55 (m, lH), 2.98-3.01 (m, lH), 2.76-2.84 (m, 6H), 1.90-2.10 (m, 4H), 1.15-1.62 (series of m, l7H), 0.90 (t, J=7.1Hz, 3H). <<7001>> |
Chromatograms |