BMFYB4CAb017
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 927-89-9 |
| KEGG | C11458 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMFYB4CAb017.mol |
| Crotono-betaine | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Crotono-betaine |
| Common Name |
|
| Symbol | |
| Formula | C7H13NO2 |
| Exact Mass | 143.0946 |
| Average Mass | 143.1836 |
| SMILES | OC(=O)[C+1]=CC[N+1](C)(C)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
- (4-Hydroxy-4-oxobutyl) -trimethylazanium ⇔ this
- this ⇔ [4- [2- [3- [ [4- [ [ [5- (6-Aminopurin-9-yl) -4-hydroxy-3-phosphonooxyoxolan-2-yl] methoxy-hydroxyphosphoryl] oxy-hydroxyphosphoryl] oxy-2-hydroxy-3,3-dimethylbutanoyl] amino] propanoylamino] ethylsulfanyl] -4-oxobut-2-enyl] -trimethylazanium
- L-Carnitine ⇔ this
