BMMCVA--0001
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 564-87-4 |
| KEGG | C02110 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCVA--0001.mol |
| 11-cis-Retinal | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 11-cis-Retinal |
| Common Name |
|
| Symbol | |
| Formula | C20H28O |
| Exact Mass | 284.214 |
| Average Mass | 284.4357 |
| SMILES | CC(=CC=CC(=CC=O)C)C=CC(C1(C)C)=C(C)CCC1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
