FLIBALNS0004
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIB Isoflavanone : FLIBAL 5,7,2',(3'),4',(5'),(6')-Trihydroxyisoflavanone and O-methyl derivatives (28 pages) : FLIBALNS Simple substitution (6 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 482-01-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIBALNS0004.mol |
| Homoferreirin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2,3-Dihydro-5,7-dihydroxy-2',4'-dimethoxyisoflavone |
| Common Name |
|
| Symbol | |
| Formula | C17H16O6 |
| Exact Mass | 316.094688244 |
| Average Mass | 316.30534 |
| SMILES | COc(c3)cc(OC)c(c3)C(C1)C(=O)c(c(O)2)c(cc(O)c2)O1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
