LBF12202HO01
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA8095 |
LipidMaps | LMFA01050152 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF12202HO01.mol |
![]() | |
Structural Information | |
Systematic Name | Methyl 4- [ 2- (2-Formylvinyl) -3-Hydroxy-5-Oxocyclopentanyl ] Butanoate |
Common Name | |
Symbol | |
Formula | C13H18O5 |
Exact Mass | 254.11542368599999 |
Average Mass | 254.27902 |
SMILES | O=CC=CC(C(O)1)C(CCCC(=O)OC)C(=O)C1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(Me-ester; after reduction WITH NaBH4 and TMS-derivatization)<<8107>>: m/e=459[M-CH3]; 443[M-OCH3]; 384[M-HOTMS]; 373[M-(CH2)3COOCH3]; 358[459-(CH2)3COOCH3]; 294[M-2xHOTMS]; 255[M-SMTOC3H5OTMS]; 243[SMTOC5H5OTMS]; 191[SMTOCHOTMS]; 167[C6H6OTMS] |
UV Spectra | |
IR Spectra | OH group: 3500cm-1; five-membered ring ketone: 1740cm-1; ester corbonyl: 1730cm-1; conjugated aldehyde: 1690cm-1; trans unsaturation: 980cm-1 <<8107>> |
NMR Spectra | |
Chromatograms |