LBF16403SC01
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0202 |
LipidMaps | LMFA01030163 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF16403SC01.mol |
![]() | |
Structural Information | |
Systematic Name | 4, 7, 10, 13-Hexadesatetraenoic acid |
Common Name | |
Symbol | |
Formula | C16H24O2 |
Exact Mass | 248.17763001199998 |
Average Mass | 248.36056 |
SMILES | CCC=CCC=CCC=CCC=CCCC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | soluble in acetone, alcohol, ether and petroleum ether.<<0448>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |