LBF17000BC01
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0238 |
LipidMaps | LMFA01020013 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF17000BC01.mol |
![]() | |
Structural Information | |
Systematic Name | 10-Methylheptadecanoic acid |
Common Name | |
Symbol | |
Formula | C18H36O2 |
Exact Mass | 284.271530396 |
Average Mass | 284.47724 |
SMILES | CCCCCCCC(C)CCCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | 33.5°C |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | soluble in acetone and glacial acetic acid<<0459>><<0525>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |