LBF18107HO02
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA8021 |
LipidMaps | LMFA01050123 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18107HO02.mol |
![]() | |
Structural Information | |
Systematic Name | 13-Hydroperoxy-9,10-Dihydroxy-11-Octadecenoic Acid |
Common Name | |
Symbol | |
Formula | C18H34O6 |
Exact Mass | 346.23553882 |
Average Mass | 346.45896 |
SMILES | CCCCCC(OO)C=CC(O)C(O)CCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(after methanolysis, reduction and trimethylsilylation), GC-EI-MS(aftre methanolysis, reduction, hydrogenation and trimethylsilylation )<<8059>> |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |