LBF18203HP03
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA8059 |
LipidMaps | LMFA01040043 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18203HP03.mol |
Structural Information | |
---|---|
Systematic Name | Methyl-13,15-Epidioxy-12-Hydroperoxy-9,16-Octadecadienoate |
Common Name | |
Symbol | |
Formula | C19H32O6 |
Exact Mass | 356.219888756 |
Average Mass | 356.45378 |
SMILES | C(O1)(CC(C=CC)O1)C(OO)CC=CCCCCCCCC(=O)OC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(after reduction(PH3P) and TMS-derivatization)<<8084>>: m/e=307[M-CH3- HOTMS]; 299[SMTO=CHCH2CH=CH(CH2)7COOCH3]; 113[M-299]; GC-EI-MS(after reduction, hydrogenation and TMS-derivatization)<<8084>>: m/e=457[M-CH3-HOTMS] |
UV Spectra | |
IR Spectra | OOH GROUP: 3660-3150cm-1[bonded], 3520cm-1[free]; olefinic protons: 3020-3002cm-1; isolated trans unsaturation: 960cm-1<<8084>> |
NMR Spectra | 1H-NMR<<8084>> |
Chromatograms |