LBF18206HO03
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA8022 |
LipidMaps | LMFA01050124 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18206HO03.mol |
![]() | |
Structural Information | |
Systematic Name | 9-Hydroxy-10,12-Octadecadienoic Acid/9-Hydroxy-10,12-Octadecadienoate |
Common Name | |
Symbol | |
Formula | C18H32O3 |
Exact Mass | 296.23514489 |
Average Mass | 296.44488 |
SMILES | CCCCCC=CC=CC(O)CCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(after methanolysis and trimethylsilylation)<<8059/8018/8012>>: m/e=382[M], 367[M-CH3], 351[M-OCH3], 311[M-(CH2)4CH3], 225[M-(CH2)7COOCH3], GC-EI-MS(after methanolysis, hydrogenation and trimethylsilylation)<<8059>>, GC-EI-MS(after methanolysis and hydrogenation)<<8064>> |
UV Spectra | Methyl ester: l/max=231, 233, 234nm <<8071>> |
IR Spectra | Methyl ester: trans, trans isomer: trans, trans conjugated diene(985cm-1), free OH(3600cm-1), bonded OH(3695-3318cm-1), trans, cis isomer: trans, cis conjugated diene(990, 968cm-1), olefinic(3005cm-1), free OH(3600cm-1), bonded OH(3700-3160cm- |
NMR Spectra | 1H-NMR(methyl ester): trans, trans olefinic protons(5.41ppm), trans,cis olefinic protons(5.91ppm), C9(4.15-4.20ppm), C14(2.07-2.10ppm)<<8017/8071>> |
Chromatograms |