LBF18206HP02
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA8003 |
LipidMaps | LMFA01040006 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18206HP02.mol |
![]() | |
Structural Information | |
Systematic Name | 10-Hydroperoxy-8,12-Octadecadienoic Acid/10-Hydroperoxy-8,12-Octadecadienoate |
Common Name | |
Symbol | |
Formula | C18H32O4 |
Exact Mass | 312.23005951199997 |
Average Mass | 312.44428 |
SMILES | CCCCCC=CCC(OO)C=CCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(after methanolysis, reduction and trimethylsilylation)<<8090/8019>>: m/e= 271[SMTO=CH-CH=CH-(CH2)6COOCH3], GC-EI-MS (after methylation, reduction and hydrogenation)<<8020>>:m/e= 201[CH(OH)(CH2)8COOCH3], 172[(CH2)8COOCH3+H], 169[C(OH)(CH2)8CO] GC-EI-MS(after methylation, reduction, hydrogenation and trimethylsilylation)<<8090>> |
UV Spectra | |
IR Spectra | After methanolyzation and reduction<<8091/8090>>: isolated double bond (3013-3010, 972-971cm-1) |
NMR Spectra | 1H-NMR(after methanolyzation and reduction)<<8091>>: olefinic protons(5.55-5.59ppm), C10 (4.08-4.11ppm) |
Chromatograms |