LBF18306SC01
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0179 |
LipidMaps | LMFA01030140 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18306SC01.mol |
Calea | |
---|---|
Structural Information | |
Systematic Name | trans-3, cis-9, cis-12-Octadecatrienoic acid |
Common Name |
|
Symbol | |
Formula | C18H30O2 |
Exact Mass | 278.224580204 |
Average Mass | 278.4296 |
SMILES | CCCCCC=CCC=CCCCCC=CCC(O)=O |
Physicochemical Information | |
Melting Point | 61-61.5°C |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | soluble in acetone, ethanol, ether, and petroleumether.<<0040>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |