LBF18403SC03
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0208 |
LipidMaps | LMFA01030169 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18403SC03.mol |
![]() | |
Structural Information | |
Systematic Name | 6, 9, 12, 15-Octadecatetraenoic acid |
Common Name | |
Symbol | |
Formula | C18H28O2 |
Exact Mass | 276.20893014 |
Average Mass | 276.41372 |
SMILES | CCC=CCC=CCC=CCC=CCCCCC(O)=O |
Physicochemical Information | |
Melting Point | -57.4 to -56.6°C |
Boiling Point | |
Density | |
Optical Rotation | 14888 at 16°C |
Reflactive Index | |
Solubility | soluble in carbon disulfide and methyl alcohol.<<0269>><<0350>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |