LBF20502SC01
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0219 |
LipidMaps | LMFA01030180 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20502SC01.mol |
Timnodonic acid | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 4, 8, 12, 15, 18-Eicosapentaenoic acid / 4, 8, 12, 15, 18-icosapentaenoic acid |
Common Name |
|
Symbol | |
Formula | C20H30O2 |
Exact Mass | 302.224580204 |
Average Mass | 302.451 |
SMILES | C(C=CCC=CCCC=CCCC=CCCC(O)=O)C=CC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | 0.9399 at 15 °C |
Optical Rotation | 1.5109 at 15 °C |
Reflactive Index | |
Solubility | soluble in benzene, chloroform, ether and petroleum ether.<<0489>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |