BMAAS5ALq001
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C05938 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMAAS5ALq001.mol |
| L-4-Hydroxyglutamate semialdehyde | |
|---|---|
| |
| Structural Information | |
| Systematic Name | L-4-Hydroxy-glutamate semialdehyde |
| Common Name |
|
| Symbol | |
| Formula | C5H9NO4 |
| Exact Mass | 147.0531 |
| Average Mass | 147.1293 |
| SMILES | O=C[C@H](O)C[C@H](N)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
