BMAAS6ANe002
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C03366 |
KNApSAcK | |
CDX file | |
MOL file | BMAAS6ANe002.mol |
5-Phosphonooxy-L-lysine | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 5-Phosphono-oxy-L-lysine |
Common Name |
|
Symbol | |
Formula | C6H15N2O6P |
Exact Mass | 242.0667 |
Average Mass | 242.1669 |
SMILES | NCC(CC[C@H](N)C(O)=O)OP(O)(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways