BMAXDP--0002
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 686-58-8 |
| KEGG | C00669 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMAXDP--0002.mol |
| gamma-L-Glutamyl-L-cysteine | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-L-Glutamyl-cysteine |
| Common Name |
|
| Symbol | |
| Formula | C8H14N2O5S |
| Exact Mass | 250.0623 |
| Average Mass | 250.2732 |
| SMILES | SC[C@H](NC(=O)CC[C@H](N)C(O)=O)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
