BMAXS3AKe003
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 5875-50-3 |
KEGG | C03492 |
KNApSAcK | |
CDX file | |
MOL file | BMAXS3AKe003.mol |
![]() | |
Structural Information | |
Systematic Name | D-4'-Phospho-pantothenic acid |
Common Name | |
Symbol | |
Formula | C9H18NO8P |
Exact Mass | 299.077 |
Average Mass | 299.2149 |
SMILES | OC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(O)(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways