BMCCCC--q002
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 42523-11-5 |
KEGG | C07724 |
KNApSAcK | |
CDX file | |
MOL file | BMCCCC--q002.mol |
1,2-Dihydroxyfluorene | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 1,2-Dihydroxy-fluorene |
Common Name |
|
Symbol | |
Formula | C13H10O2 |
Exact Mass | 198.068 |
Average Mass | 198.2172 |
SMILES | Oc(c3)c(O)c(C1)c(c3)c(c2)c(ccc2)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways