BMCCPTPTj012
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 89687-39-8 |
| KEGG | C03684 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMCCPTPTj012.mol |
| |
| Structural Information | |
| Systematic Name | 6-Pyruvoyl-5,6,7,8-tetrahydro-pterin |
| Common Name | |
| Symbol | |
| Formula | C9H11N5O3 |
| Exact Mass | 237.0861 |
| Average Mass | 237.2155 |
| SMILES | CC(=O)C(=O)C(C2)NC(C(=O)1)=C(N2)N=C(N)N1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
