BMCCPUAP0039
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C02739 |
KNApSAcK | |
CDX file | |
MOL file | BMCCPUAP0039.mol |
Phosphoribosyl-ATP | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Phosphoribosyl-ATP |
Common Name |
|
Symbol | |
Formula | C15H26N5O20P4 |
Exact Mass | 720.0121 |
Average Mass | 720.2836 |
SMILES | O[C@@H]([C@@H](O)1)[C@@H](COP(O)(O)=O)O[C@H]1[n+1] |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways