BMFYB6DAk004
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 39118-31-5 |
| KEGG | C04115 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMFYB6DAk004.mol |
| 4-Carboxy-4-hydroxy-2-oxoadipate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 4-Carboxy-4-hydroxy-2-oxo-adipic acid |
| Common Name |
|
| Symbol | |
| Formula | C7H8O8 |
| Exact Mass | 220.0219 |
| Average Mass | 220.1336 |
| SMILES | OC(=O)CC(O)(CC(=O)C(O)=O)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
