BMFYB8AMf004
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C05119 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMFYB8AMf004.mol |
| S-(3-Methylbutanoyl)-dihydrolipoamide | |
|---|---|
| |
| Structural Information | |
| Systematic Name | S-(3-Methyl-butanoyl)-dihydro-lipoamide |
| Common Name |
|
| Symbol | |
| Formula | C13H25NO2S2 |
| Exact Mass | 291.1326 |
| Average Mass | 291.4751 |
| SMILES | NC(=O)CCCCC(S)CCSC(=O)CC(C)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
- S- [2- [3- [ [4- [ [ [(2R,3S,4R,5R) -5- (6-Aminopurin-9-yl) -4-hydroxy-3-phosphonooxyoxolan-2-yl] methoxy-hydroxyphosphoryl] oxy-hydroxyphosphoryl] oxy-2-hydroxy-3,3-dimethylbutanoyl] amino] propanoylamino] ethyl] 3-methylbutanethioic acid ⇔ this
- Dihydro-lipoamide ⇔ this
- Lipoamide ⇔ this
- 2- [3- [(4-Amino-2-methylpyrimidin-5-yl) methyl] -2- (1-hydroxy-3-methylbutyl) -4-methyl-1,3-thiazol-3-ium-5-yl] ethyl phosphono hydrogen ⇔ this
