BMMCAS--d002
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 2642-80-0 |
| KEGG | C06638 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCAS--d002.mol |
| 1-Chloro-2,2-bis (4'-chlorophenyl) ethane | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 1-Chloro-2,2-bis (4'-chloro-phenyl) -ethane |
| Common Name |
|
| Symbol | |
| Formula | C14H11Cl3 |
| Exact Mass | 283.9926 |
| Average Mass | 285.5952 |
| SMILES | ClCC(c(c2)ccc(Cl)c2)c(c1)ccc(Cl)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
