BMMCBZ3Sj023
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 4228-66-4 |
KEGG | C04045 |
KNApSAcK | |
CDX file | |
MOL file | BMMCBZ3Sj023.mol |
3- (3,4-Dihydroxyphenyl) pyruvate | |
---|---|
Structural Information | |
Systematic Name | 3,4-Dihydroxy-phenyl-pyruvic acid |
Common Name |
|
Symbol | |
Formula | C9H8O5 |
Exact Mass | 196.0371 |
Average Mass | 196.1568 |
SMILES | OC(=O)C(=O)Cc(c1)cc(O)c(O)c1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways