BMMCPD--k013
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C05655 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCPD--k013.mol |
| 5-(2'-Carboxyethyl)-4,6-dihydroxypicolinate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-(2'-Carboxyethyl)-4,6-dihydroxy-picolinic acid |
| Common Name |
|
| Symbol | |
| Formula | C9H11NO6 |
| Exact Mass | 229.0586 |
| Average Mass | 229.1867 |
| SMILES | OC(=O)CCC(C(O)=1)C(O)N=C(C(O)=O)C1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
