BMMCQN--s008
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 11032-49-8 |
| KEGG | C00828 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCQN--s008.mol |
| Menaquinone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Menaquinone |
| Common Name |
|
| Symbol | |
| Formula | C21H24O2 |
| Exact Mass | 308.1776 |
| Average Mass | 308.414 |
| SMILES | CC(CCC=C(C)C)=CCc(c2C)c(c(c1)c(c2=O)ccc1)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
