FL3FALNI0012
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 554403-01-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FALNI0012.mol |
| Moralbanone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2-(2,4-Dihydroxyphenyl)-5,7-dihydroxy-8-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrienyl]-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C30H34O6 |
| Exact Mass | 490.23553882 |
| Average Mass | 490.58736000000005 |
| SMILES | c(c12)(c(cc(c1C(C=C(c(c3)c(O)cc(c3)O)O2)=O)O)O)CC= |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
