FL2F19NP0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2F19 7,(3'),(5')-Hydroxyflavanone and O-methyl derivatives (14 pages) : FL2F19NP Pyranoflavonoid (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 34198-88-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2F19NP0001.mol |
| (-) -Isolonchocarpin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | [ S, (-) ] -2,3-Dihydro-8,8-dimethyl-2-phenyl-4H,8H-benzo [ 1,2-b:3,4-b' ] dipyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C20H18O3 |
| Exact Mass | 306.12559444199997 |
| Average Mass | 306.35512 |
| SMILES | C(C3)(c(c4)cccc4)Oc(c2C(=O)3)c(c(cc2)1)C=CC(C)(C)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
