LBF18306SC02
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA0180 |
LipidMaps | LMFA01030141 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18306SC02.mol |
gamma-Linolenic acid | |
---|---|
![]() | |
Structural Information | |
Systematic Name | cis-6, cis-9, cis-12-Octadecatrienoic acid |
Common Name |
|
Symbol | |
Formula | C18H30O2 |
Exact Mass | 278.224580204 |
Average Mass | 278.4296 |
SMILES | CCCCCC=CCC=CCC=CCCCCC(O)=O |
Physicochemical Information | |
Melting Point | -11.3 to -11°C |
Boiling Point | 125°C at 0.05mmHg |
Density | dX420 0.9164 |
Optical Rotation | 1.4800 at 20°C |
Reflactive Index | |
Solubility | soluble in acetone, ether, methylalcohol and petroleum ether.<<0352>><<0383>><<0415>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |