LBF20406AM33
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7050 |
LipidMaps | LMFA08020036 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM33.mol |
![]() | |
Structural Information | |
Systematic Name | N-isopropyl alpha,alpha-dimethylarachidonoyl amide |
Common Name | |
Symbol | |
Formula | C25H43NO |
Exact Mass | 373.334465003 |
Average Mass | 373.61505999999997 |
SMILES | C(=CCC=CCC=CCC=CCCCCC)CCC(C)(C)C(NC(C)C)=O |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.20-5.50 (m, 9H), 4.04-4.14 (m, lH), 2.76-2.90 (m, 6H), 1.90-2.15 (m, 4H), 1.10-1.60 (series of m, 20H), 0.90 (t, J=6.9Hz, 3H). <<7001>> |
Chromatograms |