FL5FALGL0001
From Metabolomics.JP
(Redirected from CAS:161833-36-9)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FAL 5,7,2',(3'),4',(5'),(6')-Hydroxyflavonol and O-methyl derivatives (25 pages) : FL5FALGL 3-Glucoside and related (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 161833-36-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FALGL0001.mol |
| 3,5,7,2',3',4'-Hexahydroxyflavone 3-glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3- (beta-D-Glucopyranosyloxy) -5,7-dihydroxy-2- (2,3,4-trihydroxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C21H20O13 |
| Exact Mass | 480.090390726 |
| Average Mass | 480.37569999999994 |
| SMILES | c(c(O)4)cc(c(O)c4O)C(O2)=C(OC(C(O)3)OC(CO)C(O)C3O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
