FL5FDDGS0004
From Metabolomics.JP
(Redirected from CAS:345909-83-3)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FDD Quercetin O-methyl derivatives (4'-hydroxy-3'-methoxy, without FL5FAD, FL5FBD, FL5FCD) (21 pages) : FL5FDDGS O-Glycoside (Without 3-glycoside and 3-galactoside related) (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 345909-83-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FDDGS0004.mol |
| 5,2',4'-Trihydroxy-3,7,5'-trimethoxyflavone 2'-galactosyl- (1->4) -glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- [ 2- [ (4-O-beta-D-Galactopyranosyl-beta-D-glucopyranosyl) oxy ] -4-hydroxy-5-methoxyphenyl ] -5-hydroxy-3,7-dimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C30H36O18 |
| Exact Mass | 684.190164348 |
| Average Mass | 684.59604 |
| SMILES | c(c1OC(O5)C(C(O)C(C(CO)5)OC(O4)C(O)C(O)C(C4CO)O)O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
