FL5FA9NM0005
From Metabolomics.JP
(Redirected from CAS:79174-96-2)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FA9 5,7,(3'),(5')-Hydroxyflavonol and O-methyl derivatives (30 pages) : FL5FA9NM C-Methyl or C2/C3 substituted (5 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 79174-96-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FA9NM0005.mol |
| 5,7-Dihydroxy-3-methoxy-6,8-dimethylflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7-Dihydroxy-3-methoxy-6,8-dimethylflavone |
| Common Name |
|
| Symbol | |
| Formula | C18H16O5 |
| Exact Mass | 312.099773622 |
| Average Mass | 312.31664 |
| SMILES | c(C(O2)=C(C(c(c3O)c2c(c(c3C)O)C)=O)OC)(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
