FLIA1LNS0008
From Metabolomics.JP
(Redirected from INCHI:MSPWKPQQHHCXLR-UHFFFAOYSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIA1L 7,2',(3'),4',(5'),(6')-Hydroxyisoflavone and O-methyl derivatives (28 pages) : FLIA1LNS Simple substitution (11 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 4253-00-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIA1LNS0008.mol |
| Cuneatin methyl ether | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7,2'-Dimethoxy-4',5'-methylenedioxyisoflavone |
| Common Name |
|
| Symbol | |
| Formula | C18H14O6 |
| Exact Mass | 326.07903818 |
| Average Mass | 326.30016 |
| SMILES | c(c34)c(c(OC)cc3OCO4)C(C2=O)=COc(c21)cc(OC)cc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
