FLIDHYNS0004
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(6R,6aS,11aR)-3-Hydroxy-6-methoxy-8,9-methylenedioxypterocarpan | + | |SysName= (6R,6aS,11aR) -3-Hydroxy-6-methoxy-8,9-methylenedioxypterocarpan |
| − | |Common Name=&&6-Methoxymaackiain&&Sophoracarpan B&&(6R,6aS,11aR)-3-Hydroxy-6-methoxy-8,9-methylenedioxypterocarpan&& | + | |Common Name=&&6-Methoxymaackiain&&Sophoracarpan B&& (6R,6aS,11aR) -3-Hydroxy-6-methoxy-8,9-methylenedioxypterocarpan&& |
|CAS=104700-88-1 | |CAS=104700-88-1 | ||
|KNApSAcK=C00010011 | |KNApSAcK=C00010011 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 104700-88-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIDHYNS0004.mol |
| 6-Methoxymaackiain | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (6R,6aS,11aR) -3-Hydroxy-6-methoxy-8,9-methylenedioxypterocarpan |
| Common Name |
|
| Symbol | |
| Formula | C17H14O6 |
| Exact Mass | 314.07903818 |
| Average Mass | 314.28945999999996 |
| SMILES | COC(O1)C(c43)C(Oc(cc(O5)c(OC5)c4)3)c(c2)c(cc(O)c2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
