FLIE2ANS0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=2,3,9-Trihydroxycoumestan |
|Common Name=&&Lucernol&&2,3,9-Trihydroxycoumestan&& | |Common Name=&&Lucernol&&2,3,9-Trihydroxycoumestan&& | ||
|CAS=15402-22-9 | |CAS=15402-22-9 | ||
|KNApSAcK=C00009759 | |KNApSAcK=C00009759 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 15402-22-9 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FLIE2ANS0001.mol |
Lucernol | |
---|---|
![]() | |
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C15H8O6 |
Exact Mass | 284.032087988 |
Average Mass | 284.22042 |
SMILES | Oc(c4)cc(o1)c(c4)c(C(=O)2)c1c(c3)c(cc(O)c(O)3)O2 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|
|